C17H26N5O2+ — CID 6946276
(4-ethylpiperazin-4-ium-1-yl)-[(3S)-1-(pyrazine-2-carbonyl)piperidin-3-yl]methanone (PubChem CID 6946276) has the molecular formula C17H26N5O2+ and a molecular weight of 332.43 g/mol. Its IUPAC name is (4-ethylpiperazin-4-ium-1-yl)-[(3S)-1-(pyrazine-2-carbonyl)piperidin-3-yl]methanone.
| Compound Name | (4-ethylpiperazin-4-ium-1-yl)-[(3S)-1-(pyrazine-2-carbonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 6946276 |
| Molecular Formula | C17H26N5O2+ |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (4-ethylpiperazin-4-ium-1-yl)-[(3S)-1-(pyrazine-2-carbonyl)piperidin-3-yl]methanone |
| SMILES | CC[NH+]1CCN(C(=O)[C@H]2CCCN(C(=O)c3cnccn3)C2)CC1 |
| InChI | InChI=1S/C17H25N5O2/c1-2-20-8-10-21(11-9-20)16(23)14-4-3-7-22(13-14)17(24)15-12-18-5-6-19-15/h5-6,12,14H,2-4,7-11,13H2,1H3/p+1/t14-/m0/s1 |
| InChIKey | QQBAKAZASOZDIT-AWEZNQCLSA-O |
| XLogP | -0.92 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |