C18H28N3O3+ — CID 7419606
(4-ethylpiperazin-4-ium-1-yl)-[(3R)-1-(2-methylfuran-3-carbonyl)piperidin-3-yl]methanone (PubChem CID 7419606) has the molecular formula C18H28N3O3+ and a molecular weight of 334.44 g/mol. Its IUPAC name is (4-ethylpiperazin-4-ium-1-yl)-[(3R)-1-(2-methylfuran-3-carbonyl)piperidin-3-yl]methanone.
| Compound Name | (4-ethylpiperazin-4-ium-1-yl)-[(3R)-1-(2-methylfuran-3-carbonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 7419606 |
| Molecular Formula | C18H28N3O3+ |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (4-ethylpiperazin-4-ium-1-yl)-[(3R)-1-(2-methylfuran-3-carbonyl)piperidin-3-yl]methanone |
| SMILES | CC[NH+]1CCN(C(=O)[C@@H]2CCCN(C(=O)c3ccoc3C)C2)CC1 |
| InChI | InChI=1S/C18H27N3O3/c1-3-19-8-10-20(11-9-19)17(22)15-5-4-7-21(13-15)18(23)16-6-12-24-14(16)2/h6,12,15H,3-5,7-11,13H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | YITCUAGUAJXJOF-OAHLLOKOSA-O |
| XLogP | 0.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |