C19H29N3O5 — CID 52511320
tert-butyl N-[2-[[(3R)-1-(2-methylfuran-3-carbonyl)piperidine-3-carbonyl]amino]ethyl]carbamate (PubChem CID 52511320) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is tert-butyl N-[2-[[(3R)-1-(2-methylfuran-3-carbonyl)piperidine-3-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(3R)-1-(2-methylfuran-3-carbonyl)piperidine-3-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 52511320 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | tert-butyl N-[2-[[(3R)-1-(2-methylfuran-3-carbonyl)piperidine-3-carbonyl]amino]ethyl]carbamate |
| SMILES | Cc1occc1C(=O)N1CCC[C@@H](C(=O)NCCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H29N3O5/c1-13-15(7-11-26-13)17(24)22-10-5-6-14(12-22)16(23)20-8-9-21-18(25)27-19(2,3)4/h7,11,14H,5-6,8-10,12H2,1-4H3,(H,20,23)(H,21,25)/t14-/m1/s1 |
| InChIKey | WUVPUDMQRHDMKL-CQSZACIVSA-N |
| XLogP | 2.08 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|