C15H16N6O2S — CID 131689115
[(3aS,7aS)-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(thiadiazol-4-yl)methanone (PubChem CID 131689115) has the molecular formula C15H16N6O2S and a molecular weight of 344.40 g/mol. Its IUPAC name is [(3aS,7aS)-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(thiadiazol-4-yl)methanone.
| Compound Name | [(3aS,7aS)-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(thiadiazol-4-yl)methanone |
|---|---|
| PubChem CID | 131689115 |
| Molecular Formula | C15H16N6O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | [(3aS,7aS)-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(thiadiazol-4-yl)methanone |
| SMILES | O=C(c1cnccn1)N1CC[C@@H]2CN(C(=O)c3csnn3)C[C@H]2C1 |
| InChI | InChI=1S/C15H16N6O2S/c22-14(12-5-16-2-3-17-12)20-4-1-10-6-21(8-11(10)7-20)15(23)13-9-24-19-18-13/h2-3,5,9-11H,1,4,6-8H2/t10-,11-/m1/s1 |
| InChIKey | TYZAJGIJRQAHNX-GHMZBOCLSA-N |
| XLogP | 0.56 |
| TPSA | 92.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |