C10H14N4O3S2 — CID 131685811
[(3aR,6aR)-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-(thiadiazol-4-yl)methanone (PubChem CID 131685811) has the molecular formula C10H14N4O3S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is [(3aR,6aR)-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-(thiadiazol-4-yl)methanone.
| Compound Name | [(3aR,6aR)-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-(thiadiazol-4-yl)methanone |
|---|---|
| PubChem CID | 131685811 |
| Molecular Formula | C10H14N4O3S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | [(3aR,6aR)-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-(thiadiazol-4-yl)methanone |
| SMILES | CS(=O)(=O)N1CC[C@@H]2CN(C(=O)c3csnn3)C[C@@H]21 |
| InChI | InChI=1S/C10H14N4O3S2/c1-19(16,17)14-3-2-7-4-13(5-9(7)14)10(15)8-6-18-12-11-8/h6-7,9H,2-5H2,1H3/t7-,9+/m1/s1 |
| InChIKey | QEHZVEBHTJYCEY-APPZFPTMSA-N |
| XLogP | -0.36 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |