C10H14N4OS — CID 131686042
[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(thiadiazol-4-yl)methanone (PubChem CID 131686042) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(thiadiazol-4-yl)methanone.
| Compound Name | [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(thiadiazol-4-yl)methanone |
|---|---|
| PubChem CID | 131686042 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(thiadiazol-4-yl)methanone |
| SMILES | CN1C[C@@H]2CCN(C(=O)c3csnn3)[C@@H]2C1 |
| InChI | InChI=1S/C10H14N4OS/c1-13-4-7-2-3-14(9(7)5-13)10(15)8-6-16-12-11-8/h6-7,9H,2-5H2,1H3/t7-,9+/m0/s1 |
| InChIKey | JGXCGJCWDHKPEF-IONNQARKSA-N |
| XLogP | 0.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |