C10H11N3O5S — CID 112567973
1-(thiadiazole-4-carbonyl)piperidine-3,4-dicarboxylic acid (PubChem CID 112567973) has the molecular formula C10H11N3O5S and a molecular weight of 285.28 g/mol. Its IUPAC name is 1-(thiadiazole-4-carbonyl)piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-(thiadiazole-4-carbonyl)piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 112567973 |
| Molecular Formula | C10H11N3O5S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 1-(thiadiazole-4-carbonyl)piperidine-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)c2csnn2)CC1C(=O)O |
| InChI | InChI=1S/C10H11N3O5S/c14-8(7-4-19-12-11-7)13-2-1-5(9(15)16)6(3-13)10(17)18/h4-6H,1-3H2,(H,15,16)(H,17,18) |
| InChIKey | SMDKJPUDYTUDNG-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |