C10H15N3O2S — CID 47432669
thiadiazol-4-yl-(2,2,6-trimethylmorpholin-4-yl)methanone (PubChem CID 47432669) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is thiadiazol-4-yl-(2,2,6-trimethylmorpholin-4-yl)methanone.
| Compound Name | thiadiazol-4-yl-(2,2,6-trimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 47432669 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | thiadiazol-4-yl-(2,2,6-trimethylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2csnn2)CC(C)(C)O1 |
| InChI | InChI=1S/C10H15N3O2S/c1-7-4-13(6-10(2,3)15-7)9(14)8-5-16-12-11-8/h5,7H,4,6H2,1-3H3 |
| InChIKey | SJEYPTJEWACFDF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |