C14H19NO4 — CID 114344244
(2,3-dihydroxyphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone (PubChem CID 114344244) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2,3-dihydroxyphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone.
| Compound Name | (2,3-dihydroxyphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 114344244 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2,3-dihydroxyphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2cccc(O)c2O)CC(C)(C)O1 |
| InChI | InChI=1S/C14H19NO4/c1-9-7-15(8-14(2,3)19-9)13(18)10-5-4-6-11(16)12(10)17/h4-6,9,16-17H,7-8H2,1-3H3 |
| InChIKey | SPZKDFJUIOPWSL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|