About (2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone
(2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone (PubChem CID 62249835) has the molecular formula C14H21N3O2
and a molecular weight of 263.34 g/mol. Its IUPAC name is (2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone.
Molecular Properties
| Compound Name | (2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone |
| PubChem CID | 62249835 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccccc2NN)CC(C)(C)O1 |
| InChI | InChI=1S/C14H21N3O2/c1-10-8-17(9-14(2,3)19-10)13(18)11-6-4-5-7-12(11)16-15/h4-7,10,16H,8-9,15H2,1-3H3 |
| InChIKey | QZQLRZAIWIWLBC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone?
The IUPAC name of (2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone (CID 62249835) is (2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone.
What is the SMILES notation for (2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone?
The canonical SMILES for (2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone is CC1CN(C(=O)c2ccccc2NN)CC(C)(C)O1.
What is the InChIKey of (2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone?
The InChIKey is QZQLRZAIWIWLBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O2/c1-10-8-17(9-14(2,3)19-10)13(18)11-6-4-5-7-12(11)16-15/h4-7,10,16H,8-9,15H2,1-3H3.
What are the key properties of (2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone?
(2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone has a molecular weight of 263.34 g/mol, XLogP of 1.61, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydrazinylphenyl)-(2,2,6-trimethylmorpholin-4-yl)methanone is sourced from PubChem (CID 62249835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).