C12H17NO2S — CID 48688223
thiophen-2-yl-(2,2,6-trimethylmorpholin-4-yl)methanone (PubChem CID 48688223) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is thiophen-2-yl-(2,2,6-trimethylmorpholin-4-yl)methanone.
| Compound Name | thiophen-2-yl-(2,2,6-trimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 48688223 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | thiophen-2-yl-(2,2,6-trimethylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2cccs2)CC(C)(C)O1 |
| InChI | InChI=1S/C12H17NO2S/c1-9-7-13(8-12(2,3)15-9)11(14)10-5-4-6-16-10/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | HBQYZQOZSQLMBA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |