C12H17N3O3S — CID 131688736
[(3aR,6aR)-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-(1H-pyrrol-3-yl)methanone (PubChem CID 131688736) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is [(3aR,6aR)-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-(1H-pyrrol-3-yl)methanone.
| Compound Name | [(3aR,6aR)-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-(1H-pyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 131688736 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | [(3aR,6aR)-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-(1H-pyrrol-3-yl)methanone |
| SMILES | CS(=O)(=O)N1CC[C@@H]2CN(C(=O)c3cc[nH]c3)C[C@@H]21 |
| InChI | InChI=1S/C12H17N3O3S/c1-19(17,18)15-5-3-10-7-14(8-11(10)15)12(16)9-2-4-13-6-9/h2,4,6,10-11,13H,3,5,7-8H2,1H3/t10-,11+/m1/s1 |
| InChIKey | CAPKCWLLAUYFRC-MNOVXSKESA-N |
| XLogP | 0.12 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |