C19H25F3N2O5 — CID 155838584
[(3aR,7aR)-5-(2-methoxyethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(3-hydroxyphenyl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155838584) has the molecular formula C19H25F3N2O5 and a molecular weight of 418.41 g/mol. Its IUPAC name is [(3aR,7aR)-5-(2-methoxyethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(3-hydroxyphenyl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,7aR)-5-(2-methoxyethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(3-hydroxyphenyl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155838584 |
| Molecular Formula | C19H25F3N2O5 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [(3aR,7aR)-5-(2-methoxyethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(3-hydroxyphenyl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | COCCN1CC[C@H]2CN(C(=O)c3cccc(O)c3)C[C@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N2O3.C2HF3O2/c1-22-8-7-18-6-5-14-11-19(12-15(14)10-18)17(21)13-3-2-4-16(20)9-13;3-2(4,5)1(6)7/h2-4,9,14-15,20H,5-8,10-12H2,1H3;(H,6,7)/t14-,15+;/m0./s1 |
| InChIKey | ZXPBYTGZRSEBSR-LDXVYITESA-N |
| XLogP | 2.07 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |