C25H33F6N3O5 — CID 155855726
[(3aR,7aR)-5-(2-pyrrolidin-1-ylethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(4-methylphenyl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155855726) has the molecular formula C25H33F6N3O5 and a molecular weight of 569.54 g/mol. Its IUPAC name is [(3aR,7aR)-5-(2-pyrrolidin-1-ylethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(4-methylphenyl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(3aR,7aR)-5-(2-pyrrolidin-1-ylethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(4-methylphenyl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155855726 |
| Molecular Formula | C25H33F6N3O5 |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | [(3aR,7aR)-5-(2-pyrrolidin-1-ylethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(4-methylphenyl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(C(=O)N2C[C@H]3CN(CCN4CCCC4)CC[C@H]3C2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H31N3O.2C2HF3O2/c1-17-4-6-18(7-5-17)21(25)24-15-19-8-11-23(14-20(19)16-24)13-12-22-9-2-3-10-22;2*3-2(4,5)1(6)7/h4-7,19-20H,2-3,8-16H2,1H3;2*(H,6,7)/t19-,20+;;/m0../s1 |
| InChIKey | GHBZNNBAXIETRN-HUQPAIQZSA-N |
| XLogP | 3.75 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |