C24H35F6N3O4 — CID 154889136
1-[2-[2-methyl-4-(4-methylphenyl)piperazin-1-yl]ethyl]azepane;bis(2,2,2-trifluoroacetic acid) (PubChem CID 154889136) has the molecular formula C24H35F6N3O4 and a molecular weight of 543.55 g/mol. Its IUPAC name is 1-[2-[2-methyl-4-(4-methylphenyl)piperazin-1-yl]ethyl]azepane;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[2-[2-methyl-4-(4-methylphenyl)piperazin-1-yl]ethyl]azepane;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 154889136 |
| Molecular Formula | C24H35F6N3O4 |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 1-[2-[2-methyl-4-(4-methylphenyl)piperazin-1-yl]ethyl]azepane;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(N2CCN(CCN3CCCCCC3)C(C)C2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H33N3.2C2HF3O2/c1-18-7-9-20(10-8-18)23-16-15-22(19(2)17-23)14-13-21-11-5-3-4-6-12-21;2*3-2(4,5)1(6)7/h7-10,19H,3-6,11-17H2,1-2H3;2*(H,6,7) |
| InChIKey | XHPVWFWOBXUXAM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|