C20H28N4 — CID 56895421
5-[[2-methyl-4-(4-methylphenyl)piperazin-1-yl]methyl]-2-propylpyrimidine (PubChem CID 56895421) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is 5-[[2-methyl-4-(4-methylphenyl)piperazin-1-yl]methyl]-2-propylpyrimidine.
| Compound Name | 5-[[2-methyl-4-(4-methylphenyl)piperazin-1-yl]methyl]-2-propylpyrimidine |
|---|---|
| PubChem CID | 56895421 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 5-[[2-methyl-4-(4-methylphenyl)piperazin-1-yl]methyl]-2-propylpyrimidine |
| SMILES | CCCc1ncc(CN2CCN(c3ccc(C)cc3)CC2C)cn1 |
| InChI | InChI=1S/C20H28N4/c1-4-5-20-21-12-18(13-22-20)15-23-10-11-24(14-17(23)3)19-8-6-16(2)7-9-19/h6-9,12-13,17H,4-5,10-11,14-15H2,1-3H3 |
| InChIKey | NKICFKRPFVDQAF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|