C28H30N4O — CID 45178559
3-benzhydryl-5-[[2-methyl-4-(4-methylphenyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole (PubChem CID 45178559) has the molecular formula C28H30N4O and a molecular weight of 438.58 g/mol. Its IUPAC name is 3-benzhydryl-5-[[2-methyl-4-(4-methylphenyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-benzhydryl-5-[[2-methyl-4-(4-methylphenyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 45178559 |
| Molecular Formula | C28H30N4O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 3-benzhydryl-5-[[2-methyl-4-(4-methylphenyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole |
| SMILES | Cc1ccc(N2CCN(Cc3nc(C(c4ccccc4)c4ccccc4)no3)C(C)C2)cc1 |
| InChI | InChI=1S/C28H30N4O/c1-21-13-15-25(16-14-21)32-18-17-31(22(2)19-32)20-26-29-28(30-33-26)27(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-16,22,27H,17-20H2,1-2H3 |
| InChIKey | IDFNGHDVQTTWET-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|