C21H23ClN4O — CID 42101265
3-(4-chlorophenyl)-5-[[(2R)-2-methyl-4-(4-methylphenyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole (PubChem CID 42101265) has the molecular formula C21H23ClN4O and a molecular weight of 382.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-[[(2R)-2-methyl-4-(4-methylphenyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-(4-chlorophenyl)-5-[[(2R)-2-methyl-4-(4-methylphenyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 42101265 |
| Molecular Formula | C21H23ClN4O |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-(4-chlorophenyl)-5-[[(2R)-2-methyl-4-(4-methylphenyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole |
| SMILES | Cc1ccc(N2CCN(Cc3nc(-c4ccc(Cl)cc4)no3)[C@H](C)C2)cc1 |
| InChI | InChI=1S/C21H23ClN4O/c1-15-3-9-19(10-4-15)26-12-11-25(16(2)13-26)14-20-23-21(24-27-20)17-5-7-18(22)8-6-17/h3-10,16H,11-14H2,1-2H3/t16-/m1/s1 |
| InChIKey | YUMVMSBHJZQSSB-MRXNPFEDSA-N |
| XLogP | 4.41 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|