C23H25ClN4O2 — CID 30153604
(3S)-N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methyl-1-(4-methylphenyl)piperidine-3-carboxamide (PubChem CID 30153604) has the molecular formula C23H25ClN4O2 and a molecular weight of 424.93 g/mol. Its IUPAC name is (3S)-N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methyl-1-(4-methylphenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methyl-1-(4-methylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 30153604 |
| Molecular Formula | C23H25ClN4O2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (3S)-N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methyl-1-(4-methylphenyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(N2CCC[C@H](C(=O)N(C)Cc3nc(-c4ccc(Cl)cc4)no3)C2)cc1 |
| InChI | InChI=1S/C23H25ClN4O2/c1-16-5-11-20(12-6-16)28-13-3-4-18(14-28)23(29)27(2)15-21-25-22(26-30-21)17-7-9-19(24)10-8-17/h5-12,18H,3-4,13-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | XEMNBOQKHHZLJM-SFHVURJKSA-N |
| XLogP | 4.57 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|