C24H26Cl2N4O2 — CID 43889604
N-[[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-1-(4-methylphenyl)piperidine-3-carboxamide (PubChem CID 43889604) has the molecular formula C24H26Cl2N4O2 and a molecular weight of 473.40 g/mol. Its IUPAC name is N-[[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-1-(4-methylphenyl)piperidine-3-carboxamide.
| Compound Name | N-[[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-1-(4-methylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43889604 |
| Molecular Formula | C24H26Cl2N4O2 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-1-(4-methylphenyl)piperidine-3-carboxamide |
| SMILES | CCN(Cc1nc(-c2ccc(Cl)cc2Cl)no1)C(=O)C1CCCN(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C24H26Cl2N4O2/c1-3-29(15-22-27-23(28-32-22)20-11-8-18(25)13-21(20)26)24(31)17-5-4-12-30(14-17)19-9-6-16(2)7-10-19/h6-11,13,17H,3-5,12,14-15H2,1-2H3 |
| InChIKey | BFWKMZKHUCBGJZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|