C21H35Cl2N3O — CID 161300230
1-[4-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]propan-2-one;dihydrochloride (PubChem CID 161300230) has the molecular formula C21H35Cl2N3O and a molecular weight of 416.44 g/mol. Its IUPAC name is 1-[4-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]propan-2-one;dihydrochloride.
| Compound Name | 1-[4-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]propan-2-one;dihydrochloride |
|---|---|
| PubChem CID | 161300230 |
| Molecular Formula | C21H35Cl2N3O |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-[4-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl]propan-2-one;dihydrochloride |
| SMILES | CC(=O)CN1CCC(CCN2CCN(c3ccc(C)cc3)CC2)CC1.Cl.Cl |
| InChI | InChI=1S/C21H33N3O.2ClH/c1-18-3-5-21(6-4-18)24-15-13-22(14-16-24)10-7-20-8-11-23(12-9-20)17-19(2)25;;/h3-6,20H,7-17H2,1-2H3;2*1H |
| InChIKey | VHMWBJJEHDNFKP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|