C17H28N4 — CID 143388333
1-[2-(1-methylpiperidin-4-yl)ethyl]-4-pyridin-4-ylpiperazine (PubChem CID 143388333) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 1-[2-(1-methylpiperidin-4-yl)ethyl]-4-pyridin-4-ylpiperazine.
| Compound Name | 1-[2-(1-methylpiperidin-4-yl)ethyl]-4-pyridin-4-ylpiperazine |
|---|---|
| PubChem CID | 143388333 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1-[2-(1-methylpiperidin-4-yl)ethyl]-4-pyridin-4-ylpiperazine |
| SMILES | CN1CCC(CCN2CCN(c3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C17H28N4/c1-19-9-4-16(5-10-19)6-11-20-12-14-21(15-13-20)17-2-7-18-8-3-17/h2-3,7-8,16H,4-6,9-15H2,1H3 |
| InChIKey | PMQMLDKJMYQTKN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |