C19H28N4O3 — CID 21462820
2-[1-[3-(4-pyridin-4-ylpiperazin-1-yl)propanoyl]piperidin-4-yl]acetic acid (PubChem CID 21462820) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[1-[3-(4-pyridin-4-ylpiperazin-1-yl)propanoyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[3-(4-pyridin-4-ylpiperazin-1-yl)propanoyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 21462820 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 2-[1-[3-(4-pyridin-4-ylpiperazin-1-yl)propanoyl]piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(C(=O)CCN2CCN(c3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C19H28N4O3/c24-18(23-9-3-16(4-10-23)15-19(25)26)5-8-21-11-13-22(14-12-21)17-1-6-20-7-2-17/h1-2,6-7,16H,3-5,8-15H2,(H,25,26) |
| InChIKey | CTEXQKCCSOCFAF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |