C12H15N2O2- — CID 18918250
2-(1-pyridin-4-ylpiperidin-4-yl)acetate (PubChem CID 18918250) has the molecular formula C12H15N2O2- and a molecular weight of 219.26 g/mol. Its IUPAC name is 2-(1-pyridin-4-ylpiperidin-4-yl)acetate.
| Compound Name | 2-(1-pyridin-4-ylpiperidin-4-yl)acetate |
|---|---|
| PubChem CID | 18918250 |
| Molecular Formula | C12H15N2O2- |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-(1-pyridin-4-ylpiperidin-4-yl)acetate |
| SMILES | O=C([O-])CC1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C12H16N2O2/c15-12(16)9-10-3-7-14(8-4-10)11-1-5-13-6-2-11/h1-2,5-6,10H,3-4,7-9H2,(H,15,16)/p-1 |
| InChIKey | BOWIYWCUXAIUAB-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |