C20H28N2O4 — CID 72905387
9-(3-hydroxybenzoyl)-2-(3-methoxypropyl)-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 72905387) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 9-(3-hydroxybenzoyl)-2-(3-methoxypropyl)-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-(3-hydroxybenzoyl)-2-(3-methoxypropyl)-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 72905387 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 9-(3-hydroxybenzoyl)-2-(3-methoxypropyl)-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | COCCCN1CC2(CCC1=O)CCN(C(=O)c1cccc(O)c1)CC2 |
| InChI | InChI=1S/C20H28N2O4/c1-26-13-3-10-22-15-20(7-6-18(22)24)8-11-21(12-9-20)19(25)16-4-2-5-17(23)14-16/h2,4-5,14,23H,3,6-13,15H2,1H3 |
| InChIKey | HPXAMKRCASJAIB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|