C19H28N4O5 — CID 72921293
1-[2-[2-(3-methoxypropyl)-3-oxo-2,9-diazaspiro[5.5]undecan-9-yl]-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 72921293) has the molecular formula C19H28N4O5 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-[2-[2-(3-methoxypropyl)-3-oxo-2,9-diazaspiro[5.5]undecan-9-yl]-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-[2-(3-methoxypropyl)-3-oxo-2,9-diazaspiro[5.5]undecan-9-yl]-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 72921293 |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 1-[2-[2-(3-methoxypropyl)-3-oxo-2,9-diazaspiro[5.5]undecan-9-yl]-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | COCCCN1CC2(CCC1=O)CCN(C(=O)Cn1ccc(=O)[nH]c1=O)CC2 |
| InChI | InChI=1S/C19H28N4O5/c1-28-12-2-8-23-14-19(5-3-16(23)25)6-10-21(11-7-19)17(26)13-22-9-4-15(24)20-18(22)27/h4,9H,2-3,5-8,10-14H2,1H3,(H,20,24,27) |
| InChIKey | UAHZKIPBBQFWDW-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|