C20H32N4O3 — CID 72934308
2-(3-methoxypropyl)-9-[2-(2-methylimidazol-1-yl)propanoyl]-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 72934308) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-9-[2-(2-methylimidazol-1-yl)propanoyl]-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 2-(3-methoxypropyl)-9-[2-(2-methylimidazol-1-yl)propanoyl]-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 72934308 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 2-(3-methoxypropyl)-9-[2-(2-methylimidazol-1-yl)propanoyl]-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | COCCCN1CC2(CCC1=O)CCN(C(=O)C(C)n1ccnc1C)CC2 |
| InChI | InChI=1S/C20H32N4O3/c1-16(24-13-9-21-17(24)2)19(26)22-11-7-20(8-12-22)6-5-18(25)23(15-20)10-4-14-27-3/h9,13,16H,4-8,10-12,14-15H2,1-3H3 |
| InChIKey | SEWBGCIHUVIHJO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|