C21H31N3O3 — CID 70787450
2-(3-methoxypropyl)-N-(3-methylphenyl)-3-oxo-2,9-diazaspiro[5.5]undecane-9-carboxamide (PubChem CID 70787450) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-N-(3-methylphenyl)-3-oxo-2,9-diazaspiro[5.5]undecane-9-carboxamide.
| Compound Name | 2-(3-methoxypropyl)-N-(3-methylphenyl)-3-oxo-2,9-diazaspiro[5.5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 70787450 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2-(3-methoxypropyl)-N-(3-methylphenyl)-3-oxo-2,9-diazaspiro[5.5]undecane-9-carboxamide |
| SMILES | COCCCN1CC2(CCC1=O)CCN(C(=O)Nc1cccc(C)c1)CC2 |
| InChI | InChI=1S/C21H31N3O3/c1-17-5-3-6-18(15-17)22-20(26)23-12-9-21(10-13-23)8-7-19(25)24(16-21)11-4-14-27-2/h3,5-6,15H,4,7-14,16H2,1-2H3,(H,22,26) |
| InChIKey | SOMLSELMWREOHI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|