C23H27ClN4O2 — CID 69148071
N-(3-chloro-4-methylphenyl)-3-[5-(3-methylpyridine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide (PubChem CID 69148071) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-3-[5-(3-methylpyridine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-3-[5-(3-methylpyridine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
|---|---|
| PubChem CID | 69148071 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-3-[5-(3-methylpyridine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
| SMILES | Cc1ccc(NC(=O)CCN2CC3CN(C(=O)c4ncccc4C)CC3C2)cc1Cl |
| InChI | InChI=1S/C23H27ClN4O2/c1-15-5-6-19(10-20(15)24)26-21(29)7-9-27-11-17-13-28(14-18(17)12-27)23(30)22-16(2)4-3-8-25-22/h3-6,8,10,17-18H,7,9,11-14H2,1-2H3,(H,26,29) |
| InChIKey | BMMXVYCOTUQZBZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |