C23H30ClN5O2 — CID 69148660
N-(3-chloro-4-methylphenyl)-3-[5-(1,3,5-trimethylpyrazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide (PubChem CID 69148660) has the molecular formula C23H30ClN5O2 and a molecular weight of 443.98 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-3-[5-(1,3,5-trimethylpyrazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-3-[5-(1,3,5-trimethylpyrazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
|---|---|
| PubChem CID | 69148660 |
| Molecular Formula | C23H30ClN5O2 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-3-[5-(1,3,5-trimethylpyrazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
| SMILES | Cc1ccc(NC(=O)CCN2CC3CN(C(=O)c4c(C)nn(C)c4C)CC3C2)cc1Cl |
| InChI | InChI=1S/C23H30ClN5O2/c1-14-5-6-19(9-20(14)24)25-21(30)7-8-28-10-17-12-29(13-18(17)11-28)23(31)22-15(2)26-27(4)16(22)3/h5-6,9,17-18H,7-8,10-13H2,1-4H3,(H,25,30) |
| InChIKey | ALQNFBXAYZAPSI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |