C22H24Cl2N4O2 — CID 69145989
N-(3-chloro-4-methylphenyl)-3-[5-(3-chloropyridine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide (PubChem CID 69145989) has the molecular formula C22H24Cl2N4O2 and a molecular weight of 447.37 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-3-[5-(3-chloropyridine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-3-[5-(3-chloropyridine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
|---|---|
| PubChem CID | 69145989 |
| Molecular Formula | C22H24Cl2N4O2 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-3-[5-(3-chloropyridine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
| SMILES | Cc1ccc(NC(=O)CCN2CC3CN(C(=O)c4ncccc4Cl)CC3C2)cc1Cl |
| InChI | InChI=1S/C22H24Cl2N4O2/c1-14-4-5-17(9-19(14)24)26-20(29)6-8-27-10-15-12-28(13-16(15)11-27)22(30)21-18(23)3-2-7-25-21/h2-5,7,9,15-16H,6,8,10-13H2,1H3,(H,26,29) |
| InChIKey | FEWRTTOJHHZVGG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |