C18H26ClN3O — CID 58945958
1-[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone (PubChem CID 58945958) has the molecular formula C18H26ClN3O and a molecular weight of 335.88 g/mol. Its IUPAC name is 1-[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone.
| Compound Name | 1-[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone |
|---|---|
| PubChem CID | 58945958 |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethanone |
| SMILES | CC(=O)N1CC2CN(CCCNc3ccc(C)c(Cl)c3)CC2C1 |
| InChI | InChI=1S/C18H26ClN3O/c1-13-4-5-17(8-18(13)19)20-6-3-7-21-9-15-11-22(14(2)23)12-16(15)10-21/h4-5,8,15-16,20H,3,6-7,9-12H2,1-2H3 |
| InChIKey | UCIRXSDACMTEGG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|