C25H32ClN3O2 — CID 69147489
[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-ethoxyphenyl)methanone (PubChem CID 69147489) has the molecular formula C25H32ClN3O2 and a molecular weight of 442.00 g/mol. Its IUPAC name is [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-ethoxyphenyl)methanone.
| Compound Name | [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 69147489 |
| Molecular Formula | C25H32ClN3O2 |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-ethoxyphenyl)methanone |
| SMILES | CCOc1ccccc1C(=O)N1CC2CN(CCCNc3ccc(C)c(Cl)c3)CC2C1 |
| InChI | InChI=1S/C25H32ClN3O2/c1-3-31-24-8-5-4-7-22(24)25(30)29-16-19-14-28(15-20(19)17-29)12-6-11-27-21-10-9-18(2)23(26)13-21/h4-5,7-10,13,19-20,27H,3,6,11-12,14-17H2,1-2H3 |
| InChIKey | ASBFZUAAUSCIBU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|