C26H33ClN4O — CID 69149218
[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,2,3,4-tetrahydroisoquinolin-5-yl)methanone (PubChem CID 69149218) has the molecular formula C26H33ClN4O and a molecular weight of 453.03 g/mol. Its IUPAC name is [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,2,3,4-tetrahydroisoquinolin-5-yl)methanone.
| Compound Name | [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,2,3,4-tetrahydroisoquinolin-5-yl)methanone |
|---|---|
| PubChem CID | 69149218 |
| Molecular Formula | C26H33ClN4O |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,2,3,4-tetrahydroisoquinolin-5-yl)methanone |
| SMILES | Cc1ccc(NCCCN2CC3CN(C(=O)c4cccc5c4CCNC5)CC3C2)cc1Cl |
| InChI | InChI=1S/C26H33ClN4O/c1-18-6-7-22(12-25(18)27)29-9-3-11-30-14-20-16-31(17-21(20)15-30)26(32)24-5-2-4-19-13-28-10-8-23(19)24/h2,4-7,12,20-21,28-29H,3,8-11,13-17H2,1H3 |
| InChIKey | ZBEBVOYBJDHSRQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|