C24H28Cl2FN3O — CID 69149503
(2-chloro-6-fluoro-3-methylphenyl)-[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 69149503) has the molecular formula C24H28Cl2FN3O and a molecular weight of 464.41 g/mol. Its IUPAC name is (2-chloro-6-fluoro-3-methylphenyl)-[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (2-chloro-6-fluoro-3-methylphenyl)-[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 69149503 |
| Molecular Formula | C24H28Cl2FN3O |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | (2-chloro-6-fluoro-3-methylphenyl)-[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Cc1ccc(NCCCN2CC3CN(C(=O)c4c(F)ccc(C)c4Cl)CC3C2)cc1Cl |
| InChI | InChI=1S/C24H28Cl2FN3O/c1-15-4-6-19(10-20(15)25)28-8-3-9-29-11-17-13-30(14-18(17)12-29)24(31)22-21(27)7-5-16(2)23(22)26/h4-7,10,17-18,28H,3,8-9,11-14H2,1-2H3 |
| InChIKey | WGUDRMKUMNQDEZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|