C25H33ClN4O — CID 69147302
[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)phenyl]methanone (PubChem CID 69147302) has the molecular formula C25H33ClN4O and a molecular weight of 441.02 g/mol. Its IUPAC name is [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)phenyl]methanone.
| Compound Name | [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 69147302 |
| Molecular Formula | C25H33ClN4O |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)phenyl]methanone |
| SMILES | Cc1ccc(NCCCN2CC3CN(C(=O)c4ccc(N(C)C)cc4)CC3C2)cc1Cl |
| InChI | InChI=1S/C25H33ClN4O/c1-18-5-8-22(13-24(18)26)27-11-4-12-29-14-20-16-30(17-21(20)15-29)25(31)19-6-9-23(10-7-19)28(2)3/h5-10,13,20-21,27H,4,11-12,14-17H2,1-3H3 |
| InChIKey | NFTPHBSBAYTIFZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|