C27H33ClN4O2 — CID 69149739
[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(7-methoxy-3-methyl-1H-indol-2-yl)methanone (PubChem CID 69149739) has the molecular formula C27H33ClN4O2 and a molecular weight of 481.04 g/mol. Its IUPAC name is [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(7-methoxy-3-methyl-1H-indol-2-yl)methanone.
| Compound Name | [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(7-methoxy-3-methyl-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 69149739 |
| Molecular Formula | C27H33ClN4O2 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(7-methoxy-3-methyl-1H-indol-2-yl)methanone |
| SMILES | COc1cccc2c(C)c(C(=O)N3CC4CN(CCCNc5ccc(C)c(Cl)c5)CC4C3)[nH]c12 |
| InChI | InChI=1S/C27H33ClN4O2/c1-17-8-9-21(12-23(17)28)29-10-5-11-31-13-19-15-32(16-20(19)14-31)27(33)25-18(2)22-6-4-7-24(34-3)26(22)30-25/h4,6-9,12,19-20,29-30H,5,10-11,13-16H2,1-3H3 |
| InChIKey | HHJPEOWQXYJXEK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|