C21H26ClN3OS — CID 69148702
[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-3-ylmethanone (PubChem CID 69148702) has the molecular formula C21H26ClN3OS and a molecular weight of 403.98 g/mol. Its IUPAC name is [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-3-ylmethanone.
| Compound Name | [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 69148702 |
| Molecular Formula | C21H26ClN3OS |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-3-ylmethanone |
| SMILES | Cc1ccc(NCCCN2CC3CN(C(=O)c4ccsc4)CC3C2)cc1Cl |
| InChI | InChI=1S/C21H26ClN3OS/c1-15-3-4-19(9-20(15)22)23-6-2-7-24-10-17-12-25(13-18(17)11-24)21(26)16-5-8-27-14-16/h3-5,8-9,14,17-18,23H,2,6-7,10-13H2,1H3 |
| InChIKey | VVKTXKMWJGUFAW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|