C27H28ClF4N5O — CID 69148638
[2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[1-(4-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]methanone (PubChem CID 69148638) has the molecular formula C27H28ClF4N5O and a molecular weight of 550.00 g/mol. Its IUPAC name is [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[1-(4-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]methanone.
| Compound Name | [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[1-(4-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 69148638 |
| Molecular Formula | C27H28ClF4N5O |
| Molecular Weight | 550.00 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | [2-[3-(3-chloro-4-methylanilino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[1-(4-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]methanone |
| SMILES | Cc1ccc(NCCCN2CC3CN(C(=O)c4cnn(-c5ccc(F)cc5)c4C(F)(F)F)CC3C2)cc1Cl |
| InChI | InChI=1S/C27H28ClF4N5O/c1-17-3-6-21(11-24(17)28)33-9-2-10-35-13-18-15-36(16-19(18)14-35)26(38)23-12-34-37(25(23)27(30,31)32)22-7-4-20(29)5-8-22/h3-8,11-12,18-19,33H,2,9-10,13-16H2,1H3 |
| InChIKey | BFABKNRLMMCXFF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.00 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|