C27H27ClF3N5O2 — CID 69146881
3-(3-chloro-4-methylphenyl)-3-[5-[1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide (PubChem CID 69146881) has the molecular formula C27H27ClF3N5O2 and a molecular weight of 545.99 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-3-[5-[1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide.
| Compound Name | 3-(3-chloro-4-methylphenyl)-3-[5-[1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
|---|---|
| PubChem CID | 69146881 |
| Molecular Formula | C27H27ClF3N5O2 |
| Molecular Weight | 545.99 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-3-[5-[1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
| SMILES | Cc1ccc(C(CC(N)=O)N2CC3CN(C(=O)c4cnn(-c5ccccc5)c4C(F)(F)F)CC3C2)cc1Cl |
| InChI | InChI=1S/C27H27ClF3N5O2/c1-16-7-8-17(9-22(16)28)23(10-24(32)37)34-12-18-14-35(15-19(18)13-34)26(38)21-11-33-36(25(21)27(29,30)31)20-5-3-2-4-6-20/h2-9,11,18-19,23H,10,12-15H2,1H3,(H2,32,37) |
| InChIKey | AEVHHCDLPKKLFC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.99 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |