C25H30ClN3O4 — CID 69148422
3-(3-chloro-4-methylphenyl)-3-[5-(2,6-dimethoxybenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide (PubChem CID 69148422) has the molecular formula C25H30ClN3O4 and a molecular weight of 471.99 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-3-[5-(2,6-dimethoxybenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide.
| Compound Name | 3-(3-chloro-4-methylphenyl)-3-[5-(2,6-dimethoxybenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
|---|---|
| PubChem CID | 69148422 |
| Molecular Formula | C25H30ClN3O4 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-3-[5-(2,6-dimethoxybenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
| SMILES | COc1cccc(OC)c1C(=O)N1CC2CN(C(CC(N)=O)c3ccc(C)c(Cl)c3)CC2C1 |
| InChI | InChI=1S/C25H30ClN3O4/c1-15-7-8-16(9-19(15)26)20(10-23(27)30)28-11-17-13-29(14-18(17)12-28)25(31)24-21(32-2)5-4-6-22(24)33-3/h4-9,17-18,20H,10-14H2,1-3H3,(H2,27,30) |
| InChIKey | JZYSPQLVKSUVPQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |