C29H35ClN4O4 — CID 90930436
(3-chloro-4-methylphenyl) 1-[3-amino-1-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-oxopropyl]cyclobutane-1-carboxylate (PubChem CID 90930436) has the molecular formula C29H35ClN4O4 and a molecular weight of 539.08 g/mol. Its IUPAC name is (3-chloro-4-methylphenyl) 1-[3-amino-1-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-oxopropyl]cyclobutane-1-carboxylate.
| Compound Name | (3-chloro-4-methylphenyl) 1-[3-amino-1-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-oxopropyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 90930436 |
| Molecular Formula | C29H35ClN4O4 |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | (3-chloro-4-methylphenyl) 1-[3-amino-1-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-oxopropyl]cyclobutane-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)C2(C(CC(N)=O)N3CC4CN(C(=O)c5c(C)ccnc5C)CC4C3)CCC2)cc1Cl |
| InChI | InChI=1S/C29H35ClN4O4/c1-17-5-6-22(11-23(17)30)38-28(37)29(8-4-9-29)24(12-25(31)35)33-13-20-15-34(16-21(20)14-33)27(36)26-18(2)7-10-32-19(26)3/h5-7,10-11,20-21,24H,4,8-9,12-16H2,1-3H3,(H2,31,35) |
| InChIKey | TYDVFQZNPJVYDX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|