C23H23ClF3N3O2 — CID 69149035
3-(3-chloro-4-methylphenyl)-3-[5-(2,4,6-trifluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide (PubChem CID 69149035) has the molecular formula C23H23ClF3N3O2 and a molecular weight of 465.90 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-3-[5-(2,4,6-trifluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide.
| Compound Name | 3-(3-chloro-4-methylphenyl)-3-[5-(2,4,6-trifluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
|---|---|
| PubChem CID | 69149035 |
| Molecular Formula | C23H23ClF3N3O2 |
| Molecular Weight | 465.90 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-3-[5-(2,4,6-trifluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
| SMILES | Cc1ccc(C(CC(N)=O)N2CC3CN(C(=O)c4c(F)cc(F)cc4F)CC3C2)cc1Cl |
| InChI | InChI=1S/C23H23ClF3N3O2/c1-12-2-3-13(4-17(12)24)20(7-21(28)31)29-8-14-10-30(11-15(14)9-29)23(32)22-18(26)5-16(25)6-19(22)27/h2-6,14-15,20H,7-11H2,1H3,(H2,28,31) |
| InChIKey | KVEBBIRWBPZOAK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.90 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |