C23H28ClN3O2S — CID 69147810
3-(3-chloro-4-methylphenyl)-3-[5-(2,5-dimethylthiophene-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide (PubChem CID 69147810) has the molecular formula C23H28ClN3O2S and a molecular weight of 446.02 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-3-[5-(2,5-dimethylthiophene-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide.
| Compound Name | 3-(3-chloro-4-methylphenyl)-3-[5-(2,5-dimethylthiophene-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
|---|---|
| PubChem CID | 69147810 |
| Molecular Formula | C23H28ClN3O2S |
| Molecular Weight | 446.02 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-3-[5-(2,5-dimethylthiophene-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
| SMILES | Cc1cc(C(=O)N2CC3CN(C(CC(N)=O)c4ccc(C)c(Cl)c4)CC3C2)c(C)s1 |
| InChI | InChI=1S/C23H28ClN3O2S/c1-13-4-5-16(7-20(13)24)21(8-22(25)28)26-9-17-11-27(12-18(17)10-26)23(29)19-6-14(2)30-15(19)3/h4-7,17-18,21H,8-12H2,1-3H3,(H2,25,28) |
| InChIKey | FQFDIJKIKXOFHX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.02 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |