C28H29ClF3N5O3 — CID 69148157
3-(3-chloro-4-methylphenyl)-3-[5-[1-(4-methoxyphenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide (PubChem CID 69148157) has the molecular formula C28H29ClF3N5O3 and a molecular weight of 576.02 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-3-[5-[1-(4-methoxyphenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide.
| Compound Name | 3-(3-chloro-4-methylphenyl)-3-[5-[1-(4-methoxyphenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
|---|---|
| PubChem CID | 69148157 |
| Molecular Formula | C28H29ClF3N5O3 |
| Molecular Weight | 576.02 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-3-[5-[1-(4-methoxyphenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
| SMILES | COc1ccc(-n2ncc(C(=O)N3CC4CN(C(CC(N)=O)c5ccc(C)c(Cl)c5)CC4C3)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H29ClF3N5O3/c1-16-3-4-17(9-23(16)29)24(10-25(33)38)35-12-18-14-36(15-19(18)13-35)27(39)22-11-34-37(26(22)28(30,31)32)20-5-7-21(40-2)8-6-20/h3-9,11,18-19,24H,10,12-15H2,1-2H3,(H2,33,38) |
| InChIKey | LXQOBRYBKOFYMZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.02 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |