C21H25ClN4O3 — CID 69148453
3-(3-chloro-4-methylphenyl)-3-[5-(5-methyl-1,2-oxazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide (PubChem CID 69148453) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-3-[5-(5-methyl-1,2-oxazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide.
| Compound Name | 3-(3-chloro-4-methylphenyl)-3-[5-(5-methyl-1,2-oxazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
|---|---|
| PubChem CID | 69148453 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-3-[5-(5-methyl-1,2-oxazole-4-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
| SMILES | Cc1ccc(C(CC(N)=O)N2CC3CN(C(=O)c4cnoc4C)CC3C2)cc1Cl |
| InChI | InChI=1S/C21H25ClN4O3/c1-12-3-4-14(5-18(12)22)19(6-20(23)27)25-8-15-10-26(11-16(15)9-25)21(28)17-7-24-29-13(17)2/h3-5,7,15-16,19H,6,8-11H2,1-2H3,(H2,23,27) |
| InChIKey | RJCFIBHXQQQZAI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |