C20H24ClN3O3S2 — CID 69148074
3-(3-chloro-4-methylphenyl)-3-(5-thiophen-2-ylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)propanamide (PubChem CID 69148074) has the molecular formula C20H24ClN3O3S2 and a molecular weight of 454.02 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-3-(5-thiophen-2-ylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)propanamide.
| Compound Name | 3-(3-chloro-4-methylphenyl)-3-(5-thiophen-2-ylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)propanamide |
|---|---|
| PubChem CID | 69148074 |
| Molecular Formula | C20H24ClN3O3S2 |
| Molecular Weight | 454.02 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-3-(5-thiophen-2-ylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)propanamide |
| SMILES | Cc1ccc(C(CC(N)=O)N2CC3CN(S(=O)(=O)c4cccs4)CC3C2)cc1Cl |
| InChI | InChI=1S/C20H24ClN3O3S2/c1-13-4-5-14(7-17(13)21)18(8-19(22)25)23-9-15-11-24(12-16(15)10-23)29(26,27)20-3-2-6-28-20/h2-7,15-16,18H,8-12H2,1H3,(H2,22,25) |
| InChIKey | OJYGZULAHNIPNZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.02 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |