C17H21ClN3O3S2+ — CID 2162492
N-(5-chloro-2-methylphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide (PubChem CID 2162492) has the molecular formula C17H21ClN3O3S2+ and a molecular weight of 414.96 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 2162492 |
| Molecular Formula | C17H21ClN3O3S2+ |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C[NH+]1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H20ClN3O3S2/c1-13-4-5-14(18)11-15(13)19-16(22)12-20-6-8-21(9-7-20)26(23,24)17-3-2-10-25-17/h2-5,10-11H,6-9,12H2,1H3,(H,19,22)/p+1 |
| InChIKey | XPWBBEMNOBHQEX-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |