C20H22N3O3S2+ — CID 8745758
N-naphthalen-2-yl-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8745758) has the molecular formula C20H22N3O3S2+ and a molecular weight of 416.55 g/mol. Its IUPAC name is N-naphthalen-2-yl-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-naphthalen-2-yl-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8745758 |
| Molecular Formula | C20H22N3O3S2+ |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-naphthalen-2-yl-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide |
| SMILES | O=C(C[NH+]1CCN(S(=O)(=O)c2cccs2)CC1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H21N3O3S2/c24-19(21-18-8-7-16-4-1-2-5-17(16)14-18)15-22-9-11-23(12-10-22)28(25,26)20-6-3-13-27-20/h1-8,13-14H,9-12,15H2,(H,21,24)/p+1 |
| InChIKey | PGIZCEWVTROGDG-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |