C17H19N4O3S2+ — CID 8745828
N-(4-cyanophenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8745828) has the molecular formula C17H19N4O3S2+ and a molecular weight of 391.50 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(4-cyanophenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8745828 |
| Molecular Formula | C17H19N4O3S2+ |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N-(4-cyanophenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide |
| SMILES | N#Cc1ccc(NC(=O)C[NH+]2CCN(S(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C17H18N4O3S2/c18-12-14-3-5-15(6-4-14)19-16(22)13-20-7-9-21(10-8-20)26(23,24)17-2-1-11-25-17/h1-6,11H,7-10,13H2,(H,19,22)/p+1 |
| InChIKey | CAKNHMUYQPGLFH-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |